C24H34N2O3 — CID 58123916
ethyl 1-[(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-10-carbonyl]piperidine-3-carboxylate (PubChem CID 58123916) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is ethyl 1-[(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-10-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-10-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 58123916 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | ethyl 1-[(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-10-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)N2CC[C@@]3(C)c4ccccc4C[C@@H]2C3(C)C)C1 |
| InChI | InChI=1S/C24H34N2O3/c1-5-29-21(27)18-10-8-13-25(16-18)22(28)26-14-12-24(4)19-11-7-6-9-17(19)15-20(26)23(24,2)3/h6-7,9,11,18,20H,5,8,10,12-16H2,1-4H3/t18?,20-,24+/m1/s1 |
| InChIKey | DLCYWAPSYLMVIU-BTNBVRMJSA-N |
| XLogP | 4.00 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |