C22H32N2O2 — CID 58123559
[(1R,9S)-5-methoxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-piperidin-1-ylmethanone (PubChem CID 58123559) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is [(1R,9S)-5-methoxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-piperidin-1-ylmethanone.
| Compound Name | [(1R,9S)-5-methoxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 58123559 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | [(1R,9S)-5-methoxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-piperidin-1-ylmethanone |
| SMILES | COc1ccc2c(c1)C[C@@H]1N(C(=O)N3CCCCC3)CC[C@@]2(C)C1(C)C |
| InChI | InChI=1S/C22H32N2O2/c1-21(2)19-15-16-14-17(26-4)8-9-18(16)22(21,3)10-13-24(19)20(25)23-11-6-5-7-12-23/h8-9,14,19H,5-7,10-13,15H2,1-4H3/t19-,22+/m0/s1 |
| InChIKey | KEXFMYCKWTYAJT-SIKLNZKXSA-N |
| XLogP | 4.22 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |