C24H33N3O — CID 58124009
piperidin-1-yl-[(1S,12R)-1,6,16,16-tetramethyl-5,13-diazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]methanone (PubChem CID 58124009) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is piperidin-1-yl-[(1S,12R)-1,6,16,16-tetramethyl-5,13-diazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]methanone.
| Compound Name | piperidin-1-yl-[(1S,12R)-1,6,16,16-tetramethyl-5,13-diazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]methanone |
|---|---|
| PubChem CID | 58124009 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | piperidin-1-yl-[(1S,12R)-1,6,16,16-tetramethyl-5,13-diazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraen-13-yl]methanone |
| SMILES | CC1=Nc2cc3c(cc2C1)C[C@H]1N(C(=O)N2CCCCC2)CC[C@]3(C)C1(C)C |
| InChI | InChI=1S/C24H33N3O/c1-16-12-18-13-17-14-21-23(2,3)24(4,19(17)15-20(18)25-16)8-11-27(21)22(28)26-9-6-5-7-10-26/h13,15,21H,5-12,14H2,1-4H3/t21-,24+/m1/s1 |
| InChIKey | UKZSVOYQKBPORY-QPPBQGQZSA-N |
| XLogP | 4.86 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |