C22H29N3O — CID 58123558
(1S,9S)-1,13,13-trimethyl-10-(piperidine-1-carbonyl)-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-6-carbonitrile (PubChem CID 58123558) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is (1S,9S)-1,13,13-trimethyl-10-(piperidine-1-carbonyl)-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-6-carbonitrile.
| Compound Name | (1S,9S)-1,13,13-trimethyl-10-(piperidine-1-carbonyl)-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-6-carbonitrile |
|---|---|
| PubChem CID | 58123558 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (1S,9S)-1,13,13-trimethyl-10-(piperidine-1-carbonyl)-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-6-carbonitrile |
| SMILES | CC1(C)[C@@H]2Cc3c(C#N)cccc3[C@]1(C)CCN2C(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H29N3O/c1-21(2)19-14-17-16(15-23)8-7-9-18(17)22(21,3)10-13-25(19)20(26)24-11-5-4-6-12-24/h7-9,19H,4-6,10-14H2,1-3H3/t19-,22-/m0/s1 |
| InChIKey | OKXBUSAODZAEPK-UGKGYDQZSA-N |
| XLogP | 4.08 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |