C26H38N2O4 — CID 143893016
tert-butyl 3-[(1S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]piperidine-1-carboxylate (PubChem CID 143893016) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is tert-butyl 3-[(1S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(1S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143893016 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | tert-butyl 3-[(1S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)N2CC[C@@]3(C)c4cccc(O)c4CC2C3(C)C)C1 |
| InChI | InChI=1S/C26H38N2O4/c1-24(2,3)32-23(31)27-13-8-9-17(16-27)22(30)28-14-12-26(6)19-10-7-11-20(29)18(19)15-21(28)25(26,4)5/h7,10-11,17,21,29H,8-9,12-16H2,1-6H3/t17?,21?,26-/m0/s1 |
| InChIKey | BJDQQOUROBDUBI-MJFZFCQQSA-N |
| XLogP | 4.48 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |