C19H29N3O3 — CID 96556479
tert-butyl (3S)-3-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 96556479) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 96556479 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | tert-butyl (3S)-3-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C(=O)N2CCC[C@H]2c2ccc[nH]2)C1 |
| InChI | InChI=1S/C19H29N3O3/c1-19(2,3)25-18(24)21-11-5-7-14(13-21)17(23)22-12-6-9-16(22)15-8-4-10-20-15/h4,8,10,14,16,20H,5-7,9,11-13H2,1-3H3/t14-,16-/m0/s1 |
| InChIKey | OGDGPTSPTAOVCE-HOCLYGCPSA-N |
| XLogP | 3.33 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |