About tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde
tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde (PubChem CID 175496203) has the molecular formula C15H24N2O3
and a molecular weight of 280.37 g/mol. Its IUPAC name is tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde.
Molecular Properties
| Compound Name | tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde |
| PubChem CID | 175496203 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1.O=Cc1ccc[nH]1 |
| InChI | InChI=1S/C10H19NO2.C5H5NO/c1-10(2,3)13-9(12)11-7-5-4-6-8-11;7-4-5-2-1-3-6-5/h4-8H2,1-3H3;1-4,6H |
| InChIKey | HXZBTIFXNKKUQU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde?
The IUPAC name of tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde (CID 175496203) is tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde.
What is the SMILES notation for tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde?
The canonical SMILES for tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde is CC(C)(C)OC(=O)N1CCCCC1.O=Cc1ccc[nH]1.
What is the InChIKey of tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde?
The InChIKey is HXZBTIFXNKKUQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.C5H5NO/c1-10(2,3)13-9(12)11-7-5-4-6-8-11;7-4-5-2-1-3-6-5/h4-8H2,1-3H3;1-4,6H.
What are the key properties of tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde?
tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde has a molecular weight of 280.37 g/mol, XLogP of 3.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl piperidine-1-carboxylate;1H-pyrrole-2-carbaldehyde is sourced from PubChem (CID 175496203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).