C23H32N2O2 — CID 154380759
1-[(1R,9S)-1,13,13-trimethyl-10-(piperidine-1-carbonyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]ethanone (PubChem CID 154380759) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-[(1R,9S)-1,13,13-trimethyl-10-(piperidine-1-carbonyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]ethanone.
| Compound Name | 1-[(1R,9S)-1,13,13-trimethyl-10-(piperidine-1-carbonyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]ethanone |
|---|---|
| PubChem CID | 154380759 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 1-[(1R,9S)-1,13,13-trimethyl-10-(piperidine-1-carbonyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)[C@@]1(C)CCN(C(=O)N3CCCCC3)[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C23H32N2O2/c1-16(26)17-8-9-18-15-20-22(2,3)23(4,19(18)14-17)10-13-25(20)21(27)24-11-6-5-7-12-24/h8-9,14,20H,5-7,10-13,15H2,1-4H3/t20-,23+/m0/s1 |
| InChIKey | ZMLOMOIOASVRQA-NZQKXSOJSA-N |
| XLogP | 4.41 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |