C24H35NO4S — CID 58497727
(4-methoxycyclohexyl)-[(1S,9S)-1,13,13-trimethyl-4-methylsulfonyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone (PubChem CID 58497727) has the molecular formula C24H35NO4S and a molecular weight of 433.61 g/mol. Its IUPAC name is (4-methoxycyclohexyl)-[(1S,9S)-1,13,13-trimethyl-4-methylsulfonyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone.
| Compound Name | (4-methoxycyclohexyl)-[(1S,9S)-1,13,13-trimethyl-4-methylsulfonyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone |
|---|---|
| PubChem CID | 58497727 |
| Molecular Formula | C24H35NO4S |
| Molecular Weight | 433.61 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (4-methoxycyclohexyl)-[(1S,9S)-1,13,13-trimethyl-4-methylsulfonyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone |
| SMILES | COC1CCC(C(=O)N2CC[C@@]3(C)c4cc(S(C)(=O)=O)ccc4C[C@H]2C3(C)C)CC1 |
| InChI | InChI=1S/C24H35NO4S/c1-23(2)21-14-17-8-11-19(30(5,27)28)15-20(17)24(23,3)12-13-25(21)22(26)16-6-9-18(29-4)10-7-16/h8,11,15-16,18,21H,6-7,9-10,12-14H2,1-5H3/t16?,18?,21-,24-/m0/s1 |
| InChIKey | OSSOEHZFGSLJBN-ZWEZHYNLSA-N |
| XLogP | 3.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |