C24H33NO — CID 58497877
2-bicyclo[2.2.2]octanyl-[(1S,9S)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone (PubChem CID 58497877) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is 2-bicyclo[2.2.2]octanyl-[(1S,9S)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone.
| Compound Name | 2-bicyclo[2.2.2]octanyl-[(1S,9S)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone |
|---|---|
| PubChem CID | 58497877 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 2-bicyclo[2.2.2]octanyl-[(1S,9S)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone |
| SMILES | CC1(C)[C@@H]2Cc3ccccc3[C@]1(C)CCN2C(=O)C1CC2CCC1CC2 |
| InChI | InChI=1S/C24H33NO/c1-23(2)21-15-18-6-4-5-7-20(18)24(23,3)12-13-25(21)22(26)19-14-16-8-10-17(19)11-9-16/h4-7,16-17,19,21H,8-15H2,1-3H3/t16?,17?,19?,21-,24-/m0/s1 |
| InChIKey | XIFZAVDDPZDOGY-RPYNCZJDSA-N |
| XLogP | 4.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |