C23H25F2NO2 — CID 58375097
(3,5-difluoro-4-methoxyphenyl)-[(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone (PubChem CID 58375097) has the molecular formula C23H25F2NO2 and a molecular weight of 385.45 g/mol. Its IUPAC name is (3,5-difluoro-4-methoxyphenyl)-[(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone.
| Compound Name | (3,5-difluoro-4-methoxyphenyl)-[(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone |
|---|---|
| PubChem CID | 58375097 |
| Molecular Formula | C23H25F2NO2 |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (3,5-difluoro-4-methoxyphenyl)-[(1S,9R)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]methanone |
| SMILES | COc1c(F)cc(C(=O)N2CC[C@@]3(C)c4ccccc4C[C@@H]2C3(C)C)cc1F |
| InChI | InChI=1S/C23H25F2NO2/c1-22(2)19-13-14-7-5-6-8-16(14)23(22,3)9-10-26(19)21(27)15-11-17(24)20(28-4)18(25)12-15/h5-8,11-12,19H,9-10,13H2,1-4H3/t19-,23+/m1/s1 |
| InChIKey | FOUWBDSTQRKHDG-XXBNENTESA-N |
| XLogP | 4.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |