C27H34N2O2S — CID 143892979
[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-[(3R)-3-(phenylsulfanylamino)cyclopentyl]methanone (PubChem CID 143892979) has the molecular formula C27H34N2O2S and a molecular weight of 450.65 g/mol. Its IUPAC name is [(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-[(3R)-3-(phenylsulfanylamino)cyclopentyl]methanone.
| Compound Name | [(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-[(3R)-3-(phenylsulfanylamino)cyclopentyl]methanone |
|---|---|
| PubChem CID | 143892979 |
| Molecular Formula | C27H34N2O2S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-[(3R)-3-(phenylsulfanylamino)cyclopentyl]methanone |
| SMILES | CC1(C)[C@H]2Cc3c(O)cccc3[C@]1(C)CCN2C(=O)C1CC[C@@H](NSc2ccccc2)C1 |
| InChI | InChI=1S/C27H34N2O2S/c1-26(2)24-17-21-22(10-7-11-23(21)30)27(26,3)14-15-29(24)25(31)18-12-13-19(16-18)28-32-20-8-5-4-6-9-20/h4-11,18-19,24,28,30H,12-17H2,1-3H3/t18?,19-,24-,27+/m1/s1 |
| InChIKey | KPELNSVIVCBBFL-UXMLTAOHSA-N |
| XLogP | 5.30 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|