C23H23N3O2 — CID 58294613
(4aS)-4-(3H-indole-6-carbonyl)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-8-carboxamide (PubChem CID 58294613) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is (4aS)-4-(3H-indole-6-carbonyl)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-8-carboxamide.
| Compound Name | (4aS)-4-(3H-indole-6-carbonyl)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 58294613 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (4aS)-4-(3H-indole-6-carbonyl)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)CC[C@H]1C2CCCN1C(=O)c1ccc2c(c1)N=CC2 |
| InChI | InChI=1S/C23H23N3O2/c24-22(27)16-5-7-18-15(12-16)6-8-21-19(18)2-1-11-26(21)23(28)17-4-3-14-9-10-25-20(14)13-17/h3-5,7,10,12-13,19,21H,1-2,6,8-9,11H2,(H2,24,27)/t19?,21-/m0/s1 |
| InChIKey | PCMBJZJEXBDIDN-QWAKEFERSA-N |
| XLogP | 3.38 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |