C23H19F6N3O6S2 — CID 58294488
[(9aS)-5-methyl-1-[3-(trifluoromethylsulfonyl)benzimidazole-5-carbonyl]-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-6-yl] trifluoromethanesulfonate (PubChem CID 58294488) has the molecular formula C23H19F6N3O6S2 and a molecular weight of 611.54 g/mol. Its IUPAC name is [(9aS)-5-methyl-1-[3-(trifluoromethylsulfonyl)benzimidazole-5-carbonyl]-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-6-yl] trifluoromethanesulfonate.
| Compound Name | [(9aS)-5-methyl-1-[3-(trifluoromethylsulfonyl)benzimidazole-5-carbonyl]-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58294488 |
| Molecular Formula | C23H19F6N3O6S2 |
| Molecular Weight | 611.54 g/mol |
| Exact Mass | 611.06 |
| IUPAC Name | [(9aS)-5-methyl-1-[3-(trifluoromethylsulfonyl)benzimidazole-5-carbonyl]-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-6-yl] trifluoromethanesulfonate |
| SMILES | Cc1c(OS(=O)(=O)C(F)(F)F)ccc2c1C1CCCN(C(=O)c3ccc4ncn(S(=O)(=O)C(F)(F)F)c4c3)[C@H]1C2 |
| InChI | InChI=1S/C23H19F6N3O6S2/c1-12-19(38-40(36,37)23(27,28)29)7-5-13-9-17-15(20(12)13)3-2-8-31(17)21(33)14-4-6-16-18(10-14)32(11-30-16)39(34,35)22(24,25)26/h4-7,10-11,15,17H,2-3,8-9H2,1H3/t15?,17-/m0/s1 |
| InChIKey | IBJMHKZGFLBHOF-LWKPJOBUSA-N |
| XLogP | 4.22 |
| TPSA | 115.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|