C22H17F6N3O6S2 — CID 58294402
[(9aS)-1-[3-(trifluoromethylsulfonyl)benzimidazole-5-carbonyl]-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-6-yl] trifluoromethanesulfonate (PubChem CID 58294402) has the molecular formula C22H17F6N3O6S2 and a molecular weight of 597.52 g/mol. Its IUPAC name is [(9aS)-1-[3-(trifluoromethylsulfonyl)benzimidazole-5-carbonyl]-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-6-yl] trifluoromethanesulfonate.
| Compound Name | [(9aS)-1-[3-(trifluoromethylsulfonyl)benzimidazole-5-carbonyl]-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58294402 |
| Molecular Formula | C22H17F6N3O6S2 |
| Molecular Weight | 597.52 g/mol |
| Exact Mass | 597.05 |
| IUPAC Name | [(9aS)-1-[3-(trifluoromethylsulfonyl)benzimidazole-5-carbonyl]-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-6-yl] trifluoromethanesulfonate |
| SMILES | O=C(c1ccc2ncn(S(=O)(=O)C(F)(F)F)c2c1)N1CCCC2c3cc(OS(=O)(=O)C(F)(F)F)ccc3C[C@@H]21 |
| InChI | InChI=1S/C22H17F6N3O6S2/c23-21(24,25)38(33,34)31-11-29-17-6-4-13(9-19(17)31)20(32)30-7-1-2-15-16-10-14(5-3-12(16)8-18(15)30)37-39(35,36)22(26,27)28/h3-6,9-11,15,18H,1-2,7-8H2/t15?,18-/m0/s1 |
| InChIKey | WUDAMQDWHIRDEF-PKHIMPSTSA-N |
| XLogP | 3.91 |
| TPSA | 115.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|