C14H14F3NO — CID 87305684
1-[(4aR,9aS)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 87305684) has the molecular formula C14H14F3NO and a molecular weight of 269.27 g/mol. Its IUPAC name is 1-[(4aR,9aS)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(4aR,9aS)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 87305684 |
| Molecular Formula | C14H14F3NO |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-[(4aR,9aS)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b]pyridin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCC[C@@H]2c3ccccc3C[C@@H]21)C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO/c15-14(16,17)13(19)18-7-3-6-11-10-5-2-1-4-9(10)8-12(11)18/h1-2,4-5,11-12H,3,6-8H2/t11-,12+/m1/s1 |
| InChIKey | RKFHCVVZEYJHGO-NEPJUHHUSA-N |
| XLogP | 2.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |