C17H21F3N2O — CID 178143484
1-[(4aR,9aR)-1-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]-2,2,2-trifluoroethanone (PubChem CID 178143484) has the molecular formula C17H21F3N2O and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-[(4aR,9aR)-1-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(4aR,9aR)-1-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 178143484 |
| Molecular Formula | C17H21F3N2O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-[(4aR,9aR)-1-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCCC[C@@H]2[C@H]1CCCN2c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H21F3N2O/c18-17(19,20)16(23)22-11-5-4-9-14-15(22)10-6-12-21(14)13-7-2-1-3-8-13/h1-3,7-8,14-15H,4-6,9-12H2/t14-,15-/m1/s1 |
| InChIKey | WRCXIOWMAGMPFG-HUUCEWRRSA-N |
| XLogP | 3.60 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |