C13H12ClF3N2O2 — CID 110343933
N-(2-chlorophenyl)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 110343933) has the molecular formula C13H12ClF3N2O2 and a molecular weight of 320.70 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(2-chlorophenyl)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110343933 |
| Molecular Formula | C13H12ClF3N2O2 |
| Molecular Weight | 320.70 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | N-(2-chlorophenyl)-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)C1CCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H12ClF3N2O2/c14-8-4-1-2-5-9(8)18-11(20)10-6-3-7-19(10)12(21)13(15,16)17/h1-2,4-5,10H,3,6-7H2,(H,18,20) |
| InChIKey | JJSAZZFYGKHOFC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.70 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |