C16H19Cl3N2O2 — CID 100972177
1-(2,2-dimethylpropanoyl)-N-(3,4,5-trichlorophenyl)pyrrolidine-2-carboxamide (PubChem CID 100972177) has the molecular formula C16H19Cl3N2O2 and a molecular weight of 377.70 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N-(3,4,5-trichlorophenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N-(3,4,5-trichlorophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 100972177 |
| Molecular Formula | C16H19Cl3N2O2 |
| Molecular Weight | 377.70 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N-(3,4,5-trichlorophenyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C(=O)N1CCCC1C(=O)Nc1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H19Cl3N2O2/c1-16(2,3)15(23)21-6-4-5-12(21)14(22)20-9-7-10(17)13(19)11(18)8-9/h7-8,12H,4-6H2,1-3H3,(H,20,22) |
| InChIKey | ANIUBTKXLXZNNN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.70 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|