C17H24N2O3 — CID 47050528
1-(2,2-dimethylpropanoyl)-N-(2-hydroxy-4-methylphenyl)pyrrolidine-2-carboxamide (PubChem CID 47050528) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N-(2-hydroxy-4-methylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N-(2-hydroxy-4-methylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 47050528 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N-(2-hydroxy-4-methylphenyl)pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCCN2C(=O)C(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-11-7-8-12(14(20)10-11)18-15(21)13-6-5-9-19(13)16(22)17(2,3)4/h7-8,10,13,20H,5-6,9H2,1-4H3,(H,18,21) |
| InChIKey | KEDJIKGMWMTFQZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|