C23H30FN5O2 — CID 56573136
1-(2,2-dimethylpropanoyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 56573136) has the molecular formula C23H30FN5O2 and a molecular weight of 427.52 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56573136 |
| Molecular Formula | C23H30FN5O2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C(=O)N1CCCC1C(=O)Nc1cc(-c2nnc3n2CCCCC3)ccc1F |
| InChI | InChI=1S/C23H30FN5O2/c1-23(2,3)22(31)28-13-7-8-18(28)21(30)25-17-14-15(10-11-16(17)24)20-27-26-19-9-5-4-6-12-29(19)20/h10-11,14,18H,4-9,12-13H2,1-3H3,(H,25,30) |
| InChIKey | JNXYHEQBDGWDEJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |