C22H26FN5O4S — CID 55668367
5-(tert-butylsulfamoyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]furan-2-carboxamide (PubChem CID 55668367) has the molecular formula C22H26FN5O4S and a molecular weight of 475.55 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(tert-butylsulfamoyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55668367 |
| Molecular Formula | C22H26FN5O4S |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]furan-2-carboxamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)Nc2cc(-c3nnc4n3CCCCC4)ccc2F)o1 |
| InChI | InChI=1S/C22H26FN5O4S/c1-22(2,3)27-33(30,31)19-11-10-17(32-19)21(29)24-16-13-14(8-9-15(16)23)20-26-25-18-7-5-4-6-12-28(18)20/h8-11,13,27H,4-7,12H2,1-3H3,(H,24,29) |
| InChIKey | CVBRZCZPTKEQEA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 119.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |