C24H20F2N4O2 — CID 55550678
5-(4-fluorophenyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]furan-2-carboxamide (PubChem CID 55550678) has the molecular formula C24H20F2N4O2 and a molecular weight of 434.45 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55550678 |
| Molecular Formula | C24H20F2N4O2 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(-c2nnc3n2CCCCC3)ccc1F)c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C24H20F2N4O2/c25-17-8-5-15(6-9-17)20-11-12-21(32-20)24(31)27-19-14-16(7-10-18(19)26)23-29-28-22-4-2-1-3-13-30(22)23/h5-12,14H,1-4,13H2,(H,27,31) |
| InChIKey | OPZVLPLKTKQTBK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |