C18H24Cl2FN5O2 — CID 119841733
N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]morpholine-3-carboxamide;dihydrochloride (PubChem CID 119841733) has the molecular formula C18H24Cl2FN5O2 and a molecular weight of 432.33 g/mol. Its IUPAC name is N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]morpholine-3-carboxamide;dihydrochloride.
| Compound Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]morpholine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119841733 |
| Molecular Formula | C18H24Cl2FN5O2 |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]morpholine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1cc(-c2nnc3n2CCCCC3)ccc1F)C1COCCN1 |
| InChI | InChI=1S/C18H22FN5O2.2ClH/c19-13-6-5-12(17-23-22-16-4-2-1-3-8-24(16)17)10-14(13)21-18(25)15-11-26-9-7-20-15;;/h5-6,10,15,20H,1-4,7-9,11H2,(H,21,25);2*1H |
| InChIKey | LLAZJYDJYHVWOU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |