C21H26FN5O3S — CID 55550669
N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide (PubChem CID 55550669) has the molecular formula C21H26FN5O3S and a molecular weight of 447.54 g/mol. Its IUPAC name is N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide.
| Compound Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide |
|---|---|
| PubChem CID | 55550669 |
| Molecular Formula | C21H26FN5O3S |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide |
| SMILES | O=C(CSCC(=O)N1CCOCC1)Nc1cc(-c2nnc3n2CCCCC3)ccc1F |
| InChI | InChI=1S/C21H26FN5O3S/c22-16-6-5-15(21-25-24-18-4-2-1-3-7-27(18)21)12-17(16)23-19(28)13-31-14-20(29)26-8-10-30-11-9-26/h5-6,12H,1-4,7-11,13-14H2,(H,23,28) |
| InChIKey | XJPSNFGBOPRTCZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |