C18H21Cl2FN6OS — CID 119841775
2-(aminomethyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1,3-thiazole-4-carboxamide;dihydrochloride (PubChem CID 119841775) has the molecular formula C18H21Cl2FN6OS and a molecular weight of 459.38 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1,3-thiazole-4-carboxamide;dihydrochloride.
| Compound Name | 2-(aminomethyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1,3-thiazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119841775 |
| Molecular Formula | C18H21Cl2FN6OS |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 2-(aminomethyl)-N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1,3-thiazole-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCc1nc(C(=O)Nc2cc(-c3nnc4n3CCCCC4)ccc2F)cs1 |
| InChI | InChI=1S/C18H19FN6OS.2ClH/c19-12-6-5-11(17-24-23-15-4-2-1-3-7-25(15)17)8-13(12)22-18(26)14-10-27-16(9-20)21-14;;/h5-6,8,10H,1-4,7,9,20H2,(H,22,26);2*1H |
| InChIKey | XHELZDGQOMQLQS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |