C19H22N6OS — CID 119842674
2-(aminomethyl)-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 119842674) has the molecular formula C19H22N6OS and a molecular weight of 382.49 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 119842674 |
| Molecular Formula | C19H22N6OS |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-(aminomethyl)-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(-c2nnc3n2CCCCC3)cc1NC(=O)c1csc(CN)n1 |
| InChI | InChI=1S/C19H22N6OS/c1-12-6-7-13(18-24-23-16-5-3-2-4-8-25(16)18)9-14(12)22-19(26)15-11-27-17(10-20)21-15/h6-7,9,11H,2-5,8,10,20H2,1H3,(H,22,26) |
| InChIKey | JXPPDUPCDUFSIY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |