C20H22N4OS — CID 35010182
5-methyl-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiophene-2-carboxamide (PubChem CID 35010182) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 5-methyl-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiophene-2-carboxamide.
| Compound Name | 5-methyl-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 35010182 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 5-methyl-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(-c3nnc4n3CCCCC4)ccc2C)s1 |
| InChI | InChI=1S/C20H22N4OS/c1-13-7-9-15(19-23-22-18-6-4-3-5-11-24(18)19)12-16(13)21-20(25)17-10-8-14(2)26-17/h7-10,12H,3-6,11H2,1-2H3,(H,21,25) |
| InChIKey | IIXCMIZPSNWLFX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |