C19H29Cl2N5O — CID 119842665
2-methyl-3-(methylamino)-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]propanamide;dihydrochloride (PubChem CID 119842665) has the molecular formula C19H29Cl2N5O and a molecular weight of 414.38 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]propanamide;dihydrochloride.
| Compound Name | 2-methyl-3-(methylamino)-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119842665 |
| Molecular Formula | C19H29Cl2N5O |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]propanamide;dihydrochloride |
| SMILES | CNCC(C)C(=O)Nc1cc(-c2nnc3n2CCCCC3)ccc1C.Cl.Cl |
| InChI | InChI=1S/C19H27N5O.2ClH/c1-13-8-9-15(11-16(13)21-19(25)14(2)12-20-3)18-23-22-17-7-5-4-6-10-24(17)18;;/h8-9,11,14,20H,4-7,10,12H2,1-3H3,(H,21,25);2*1H |
| InChIKey | RKLSBGNWOTZLHN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |