C22H20FN7OS — CID 55870834
N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 55870834) has the molecular formula C22H20FN7OS and a molecular weight of 449.52 g/mol. Its IUPAC name is N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55870834 |
| Molecular Formula | C22H20FN7OS |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ncccn2)sc1C(=O)Nc1cc(-c2nnc3n2CCCCC3)ccc1F |
| InChI | InChI=1S/C22H20FN7OS/c1-13-18(32-22(26-13)19-24-9-5-10-25-19)21(31)27-16-12-14(7-8-15(16)23)20-29-28-17-6-3-2-4-11-30(17)20/h5,7-10,12H,2-4,6,11H2,1H3,(H,27,31) |
| InChIKey | PXWDXUODFLRAFS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |