C26H27N5O2S — CID 46408487
2-(4-ethoxyphenyl)-4-methyl-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 46408487) has the molecular formula C26H27N5O2S and a molecular weight of 473.60 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-4-methyl-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-4-methyl-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 46408487 |
| Molecular Formula | C26H27N5O2S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-(4-ethoxyphenyl)-4-methyl-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C)c(C(=O)Nc3ccc(-c4nnc5n4CCCCC5)cc3)s2)cc1 |
| InChI | InChI=1S/C26H27N5O2S/c1-3-33-21-14-10-19(11-15-21)26-27-17(2)23(34-26)25(32)28-20-12-8-18(9-13-20)24-30-29-22-7-5-4-6-16-31(22)24/h8-15H,3-7,16H2,1-2H3,(H,28,32) |
| InChIKey | ILSXRNRNDKNJRK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |