C24H32FN5O3 — CID 55549549
tert-butyl 3-[[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 55549549) has the molecular formula C24H32FN5O3 and a molecular weight of 457.55 g/mol. Its IUPAC name is tert-butyl 3-[[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 55549549 |
| Molecular Formula | C24H32FN5O3 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | tert-butyl 3-[[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)Nc2cc(-c3nnc4n3CCCCC4)ccc2F)C1 |
| InChI | InChI=1S/C24H32FN5O3/c1-24(2,3)33-23(32)29-12-7-8-17(15-29)22(31)26-19-14-16(10-11-18(19)25)21-28-27-20-9-5-4-6-13-30(20)21/h10-11,14,17H,4-9,12-13,15H2,1-3H3,(H,26,31) |
| InChIKey | UVXWCOSUPKNLII-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |