C15H19NO2 — CID 79539176
6-methoxy-2-piperidin-2-yl-2,3-dihydroinden-1-one (PubChem CID 79539176) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 6-methoxy-2-piperidin-2-yl-2,3-dihydroinden-1-one.
| Compound Name | 6-methoxy-2-piperidin-2-yl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 79539176 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 6-methoxy-2-piperidin-2-yl-2,3-dihydroinden-1-one |
| SMILES | COc1ccc2c(c1)C(=O)C(C1CCCCN1)C2 |
| InChI | InChI=1S/C15H19NO2/c1-18-11-6-5-10-8-13(15(17)12(10)9-11)14-4-2-3-7-16-14/h5-6,9,13-14,16H,2-4,7-8H2,1H3 |
| InChIKey | LUJSYSMXAXUBQR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |