C11H8Cl2O — CID 2776683
2,2-dichloro-7,7a-dihydro-2aH-cyclobuta[a]inden-1-one (PubChem CID 2776683) has the molecular formula C11H8Cl2O and a molecular weight of 227.09 g/mol. Its IUPAC name is 2,2-dichloro-7,7a-dihydro-2aH-cyclobuta[a]inden-1-one.
| Compound Name | 2,2-dichloro-7,7a-dihydro-2aH-cyclobuta[a]inden-1-one |
|---|---|
| PubChem CID | 2776683 |
| Molecular Formula | C11H8Cl2O |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 2,2-dichloro-7,7a-dihydro-2aH-cyclobuta[a]inden-1-one |
| SMILES | O=C1C2Cc3ccccc3C2C1(Cl)Cl |
| InChI | InChI=1S/C11H8Cl2O/c12-11(13)9-7-4-2-1-3-6(7)5-8(9)10(11)14/h1-4,8-9H,5H2 |
| InChIKey | KAGZBEUEDMPZCQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|