C33H28Cl2O7 — CID 167682357
1,2a,3,8b-tetrahydrocyclobuta[c]chromen-2-one;1,3a,4,9b-tetrahydrofuro[2,3-c]chromen-2-one;1,1-dichloro-3,8b-dihydro-2aH-cyclobuta[c]chromen-2-one (PubChem CID 167682357) has the molecular formula C33H28Cl2O7 and a molecular weight of 607.49 g/mol. Its IUPAC name is 1,2a,3,8b-tetrahydrocyclobuta[c]chromen-2-one;1,3a,4,9b-tetrahydrofuro[2,3-c]chromen-2-one;1,1-dichloro-3,8b-dihydro-2aH-cyclobuta[c]chromen-2-one.
| Compound Name | 1,2a,3,8b-tetrahydrocyclobuta[c]chromen-2-one;1,3a,4,9b-tetrahydrofuro[2,3-c]chromen-2-one;1,1-dichloro-3,8b-dihydro-2aH-cyclobuta[c]chromen-2-one |
|---|---|
| PubChem CID | 167682357 |
| Molecular Formula | C33H28Cl2O7 |
| Molecular Weight | 607.49 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | 1,2a,3,8b-tetrahydrocyclobuta[c]chromen-2-one;1,3a,4,9b-tetrahydrofuro[2,3-c]chromen-2-one;1,1-dichloro-3,8b-dihydro-2aH-cyclobuta[c]chromen-2-one |
| SMILES | O=C1C2COc3ccccc3C2C1(Cl)Cl.O=C1CC2c3ccccc3OCC12.O=C1CC2c3ccccc3OCC2O1 |
| InChI | InChI=1S/C11H8Cl2O2.C11H10O3.C11H10O2/c12-11(13)9-6-3-1-2-4-8(6)15-5-7(9)10(11)14;12-11-5-8-7-3-1-2-4-9(7)13-6-10(8)14-11;12-10-5-8-7-3-1-2-4-11(7)13-6-9(8)10/h1-4,7,9H,5H2;1-4,8,10H,5-6H2;1-4,8-9H,5-6H2 |
| InChIKey | VSLWCUOYYLBOEA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|