C22H18Cl2O4 — CID 158589230
1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one;1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one (PubChem CID 158589230) has the molecular formula C22H18Cl2O4 and a molecular weight of 417.29 g/mol. Its IUPAC name is 1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one;1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one.
| Compound Name | 1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one;1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one |
|---|---|
| PubChem CID | 158589230 |
| Molecular Formula | C22H18Cl2O4 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one;1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one |
| SMILES | O=C1CC2c3ccccc3CC2O1.O=C1OC2Cc3ccccc3C2C1(Cl)Cl |
| InChI | InChI=1S/C11H8Cl2O2.C11H10O2/c12-11(13)9-7-4-2-1-3-6(7)5-8(9)15-10(11)14;12-11-6-9-8-4-2-1-3-7(8)5-10(9)13-11/h1-4,8-9H,5H2;1-4,9-10H,5-6H2 |
| InChIKey | HUFUEAVUOZOXJG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|