C10H10O3 — CID 15696258
(1S,2S)-2-hydroxy-2,3-dihydro-1H-indene-1-carboxylic acid (PubChem CID 15696258) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is (1S,2S)-2-hydroxy-2,3-dihydro-1H-indene-1-carboxylic acid.
| Compound Name | (1S,2S)-2-hydroxy-2,3-dihydro-1H-indene-1-carboxylic acid |
|---|---|
| PubChem CID | 15696258 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (1S,2S)-2-hydroxy-2,3-dihydro-1H-indene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C10H10O3/c11-8-5-6-3-1-2-4-7(6)9(8)10(12)13/h1-4,8-9,11H,5H2,(H,12,13)/t8-,9-/m0/s1 |
| InChIKey | HLYJBRIRRUNJAC-IUCAKERBSA-N |
| XLogP | 0.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |