C10H10O4P+ — CID 7720814
[(1R,2S)-1-carboxy-2,3-dihydro-1H-inden-2-yl]-hydroxy-oxophosphanium (PubChem CID 7720814) has the molecular formula C10H10O4P+ and a molecular weight of 225.16 g/mol. Its IUPAC name is [(1R,2S)-1-carboxy-2,3-dihydro-1H-inden-2-yl]-hydroxy-oxophosphanium.
| Compound Name | [(1R,2S)-1-carboxy-2,3-dihydro-1H-inden-2-yl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 7720814 |
| Molecular Formula | C10H10O4P+ |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | [(1R,2S)-1-carboxy-2,3-dihydro-1H-inden-2-yl]-hydroxy-oxophosphanium |
| SMILES | O=C(O)[C@H]1c2ccccc2C[C@@H]1[P+](=O)O |
| InChI | InChI=1S/C10H9O4P/c11-10(12)9-7-4-2-1-3-6(7)5-8(9)15(13)14/h1-4,8-9H,5H2,(H-,11,12,13,14)/p+1/t8-,9-/m0/s1 |
| InChIKey | BSUSNOFAXQHJIT-IUCAKERBSA-O |
| XLogP | 1.51 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|