C10H9O4P — CID 7720818
(1S,2S)-2-[hydroxy(oxo)phosphaniumyl]-2,3-dihydro-1H-indene-1-carboxylate (PubChem CID 7720818) has the molecular formula C10H9O4P and a molecular weight of 224.15 g/mol. Its IUPAC name is (1S,2S)-2-[hydroxy(oxo)phosphaniumyl]-2,3-dihydro-1H-indene-1-carboxylate.
| Compound Name | (1S,2S)-2-[hydroxy(oxo)phosphaniumyl]-2,3-dihydro-1H-indene-1-carboxylate |
|---|---|
| PubChem CID | 7720818 |
| Molecular Formula | C10H9O4P |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | (1S,2S)-2-[hydroxy(oxo)phosphaniumyl]-2,3-dihydro-1H-indene-1-carboxylate |
| SMILES | O=C([O-])[C@@H]1c2ccccc2C[C@@H]1[P+](=O)O |
| InChI | InChI=1S/C10H9O4P/c11-10(12)9-7-4-2-1-3-6(7)5-8(9)15(13)14/h1-4,8-9H,5H2,(H-,11,12,13,14)/t8-,9+/m0/s1 |
| InChIKey | BSUSNOFAXQHJIT-DTWKUNHWSA-N |
| XLogP | 0.18 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|