C10H8O5P-3 — CID 7707687
(1R,2S)-2-phosphonato-2,3-dihydro-1H-indene-1-carboxylate (PubChem CID 7707687) has the molecular formula C10H8O5P-3 and a molecular weight of 239.14 g/mol. Its IUPAC name is (1R,2S)-2-phosphonato-2,3-dihydro-1H-indene-1-carboxylate.
| Compound Name | (1R,2S)-2-phosphonato-2,3-dihydro-1H-indene-1-carboxylate |
|---|---|
| PubChem CID | 7707687 |
| Molecular Formula | C10H8O5P-3 |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | (1R,2S)-2-phosphonato-2,3-dihydro-1H-indene-1-carboxylate |
| SMILES | O=C([O-])[C@H]1c2ccccc2C[C@@H]1P(=O)([O-])[O-] |
| InChI | InChI=1S/C10H11O5P/c11-10(12)9-7-4-2-1-3-6(7)5-8(9)16(13,14)15/h1-4,8-9H,5H2,(H,11,12)(H2,13,14,15)/p-3/t8-,9-/m0/s1 |
| InChIKey | KKSDRURVDFGMTQ-IUCAKERBSA-K |
| XLogP | -1.64 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|