C13H18NO4P — CID 7714837
(1S,2S)-2-[(dimethylamino)methyl-hydroxyphosphoryl]-2,3-dihydro-1H-indene-1-carboxylic acid (PubChem CID 7714837) has the molecular formula C13H18NO4P and a molecular weight of 283.26 g/mol. Its IUPAC name is (1S,2S)-2-[(dimethylamino)methyl-hydroxyphosphoryl]-2,3-dihydro-1H-indene-1-carboxylic acid.
| Compound Name | (1S,2S)-2-[(dimethylamino)methyl-hydroxyphosphoryl]-2,3-dihydro-1H-indene-1-carboxylic acid |
|---|---|
| PubChem CID | 7714837 |
| Molecular Formula | C13H18NO4P |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (1S,2S)-2-[(dimethylamino)methyl-hydroxyphosphoryl]-2,3-dihydro-1H-indene-1-carboxylic acid |
| SMILES | CN(C)CP(=O)(O)[C@H]1Cc2ccccc2[C@H]1C(=O)O |
| InChI | InChI=1S/C13H18NO4P/c1-14(2)8-19(17,18)11-7-9-5-3-4-6-10(9)12(11)13(15)16/h3-6,11-12H,7-8H2,1-2H3,(H,15,16)(H,17,18)/t11-,12+/m0/s1 |
| InChIKey | AVXJHCOALLFXGU-NWDGAFQWSA-N |
| XLogP | 1.57 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|