C14H24N2O5S2 — CID 158628530
2-[amino(methyl)amino]-2,3-dihydro-1H-inden-1-ol;butanedioic acid;sulfane (PubChem CID 158628530) has the molecular formula C14H24N2O5S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-2,3-dihydro-1H-inden-1-ol;butanedioic acid;sulfane.
| Compound Name | 2-[amino(methyl)amino]-2,3-dihydro-1H-inden-1-ol;butanedioic acid;sulfane |
|---|---|
| PubChem CID | 158628530 |
| Molecular Formula | C14H24N2O5S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[amino(methyl)amino]-2,3-dihydro-1H-inden-1-ol;butanedioic acid;sulfane |
| SMILES | CN(N)C1Cc2ccccc2C1O.O=C(O)CCC(=O)O.S.S |
| InChI | InChI=1S/C10H14N2O.C4H6O4.2H2S/c1-12(11)9-6-7-4-2-3-5-8(7)10(9)13;5-3(6)1-2-4(7)8;;/h2-5,9-10,13H,6,11H2,1H3;1-2H2,(H,5,6)(H,7,8);2*1H2 |
| InChIKey | HYXACBINULOFLA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|