C13H19NO — CID 131856725
(1S,2R)-2-(diethylamino)-2,3-dihydro-1H-inden-1-ol (PubChem CID 131856725) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (1S,2R)-2-(diethylamino)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1S,2R)-2-(diethylamino)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 131856725 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (1S,2R)-2-(diethylamino)-2,3-dihydro-1H-inden-1-ol |
| SMILES | CCN(CC)[C@@H]1Cc2ccccc2[C@@H]1O |
| InChI | InChI=1S/C13H19NO/c1-3-14(4-2)12-9-10-7-5-6-8-11(10)13(12)15/h5-8,12-13,15H,3-4,9H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | AENRGZKELHPZCY-OLZOCXBDSA-N |
| XLogP | 1.99 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |