C12H14N2O2 — CID 68988883
2-N-methyl-2,3-dihydro-1H-indene-1,2-dicarboxamide (PubChem CID 68988883) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-N-methyl-2,3-dihydro-1H-indene-1,2-dicarboxamide.
| Compound Name | 2-N-methyl-2,3-dihydro-1H-indene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 68988883 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-N-methyl-2,3-dihydro-1H-indene-1,2-dicarboxamide |
| SMILES | CNC(=O)C1Cc2ccccc2C1C(N)=O |
| InChI | InChI=1S/C12H14N2O2/c1-14-12(16)9-6-7-4-2-3-5-8(7)10(9)11(13)15/h2-5,9-10H,6H2,1H3,(H2,13,15)(H,14,16) |
| InChIKey | NJLQFTRQUVOGSW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |