About 8-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide
8-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide (PubChem CID 45084610) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 8-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide.
Analyze 8-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide?
The IUPAC name of 8-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide (CID 45084610) is 8-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide.
What is the SMILES notation for 8-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide?
The canonical SMILES for 8-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide is CC1c2ccccc2C1C(N)=O.
What is the InChIKey of 8-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide?
The InChIKey is KBKXSRCCMFEDSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-6-7-4-2-3-5-8(7)9(6)10(11)12/h2-6,9H,1H3,(H2,11,12).
What are the key properties of 8-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide?
8-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide has a molecular weight of 161.20 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide is sourced from PubChem (CID 45084610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).