C11H13NOS — CID 71995241
N-methyl-3,4-dihydro-1H-isothiochromene-1-carboxamide (PubChem CID 71995241) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is N-methyl-3,4-dihydro-1H-isothiochromene-1-carboxamide.
| Compound Name | N-methyl-3,4-dihydro-1H-isothiochromene-1-carboxamide |
|---|---|
| PubChem CID | 71995241 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | N-methyl-3,4-dihydro-1H-isothiochromene-1-carboxamide |
| SMILES | CNC(=O)C1SCCc2ccccc21 |
| InChI | InChI=1S/C11H13NOS/c1-12-11(13)10-9-5-3-2-4-8(9)6-7-14-10/h2-5,10H,6-7H2,1H3,(H,12,13) |
| InChIKey | LOFLYIFADHWSNO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |