C10H10O2S — CID 54595778
3,4-dihydro-1H-isothiochromene-1-carboxylic acid (PubChem CID 54595778) has the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. Its IUPAC name is 3,4-dihydro-1H-isothiochromene-1-carboxylic acid.
| Compound Name | 3,4-dihydro-1H-isothiochromene-1-carboxylic acid |
|---|---|
| PubChem CID | 54595778 |
| Molecular Formula | C10H10O2S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 3,4-dihydro-1H-isothiochromene-1-carboxylic acid |
| SMILES | O=C(O)C1SCCc2ccccc21 |
| InChI | InChI=1S/C10H10O2S/c11-10(12)9-8-4-2-1-3-7(8)5-6-13-9/h1-4,9H,5-6H2,(H,11,12) |
| InChIKey | DFJHJOVHYMRRGW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |