C15H19NO3S2 — CID 97047071
(1R)-N-cyclopentylsulfonyl-3,4-dihydro-1H-isothiochromene-1-carboxamide (PubChem CID 97047071) has the molecular formula C15H19NO3S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is (1R)-N-cyclopentylsulfonyl-3,4-dihydro-1H-isothiochromene-1-carboxamide.
| Compound Name | (1R)-N-cyclopentylsulfonyl-3,4-dihydro-1H-isothiochromene-1-carboxamide |
|---|---|
| PubChem CID | 97047071 |
| Molecular Formula | C15H19NO3S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (1R)-N-cyclopentylsulfonyl-3,4-dihydro-1H-isothiochromene-1-carboxamide |
| SMILES | O=C(NS(=O)(=O)C1CCCC1)[C@@H]1SCCc2ccccc21 |
| InChI | InChI=1S/C15H19NO3S2/c17-15(16-21(18,19)12-6-2-3-7-12)14-13-8-4-1-5-11(13)9-10-20-14/h1,4-5,8,12,14H,2-3,6-7,9-10H2,(H,16,17)/t14-/m1/s1 |
| InChIKey | NAKFOHWKHNHINN-CQSZACIVSA-N |
| XLogP | 2.41 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |