C16H21NO4S — CID 99714516
(1R)-N-cyclohexylsulfonyl-3,4-dihydro-1H-isochromene-1-carboxamide (PubChem CID 99714516) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is (1R)-N-cyclohexylsulfonyl-3,4-dihydro-1H-isochromene-1-carboxamide.
| Compound Name | (1R)-N-cyclohexylsulfonyl-3,4-dihydro-1H-isochromene-1-carboxamide |
|---|---|
| PubChem CID | 99714516 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (1R)-N-cyclohexylsulfonyl-3,4-dihydro-1H-isochromene-1-carboxamide |
| SMILES | O=C(NS(=O)(=O)C1CCCCC1)[C@@H]1OCCc2ccccc21 |
| InChI | InChI=1S/C16H21NO4S/c18-16(17-22(19,20)13-7-2-1-3-8-13)15-14-9-5-4-6-12(14)10-11-21-15/h4-6,9,13,15H,1-3,7-8,10-11H2,(H,17,18)/t15-/m1/s1 |
| InChIKey | MIENMZGWRLBNGU-OAHLLOKOSA-N |
| XLogP | 2.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |