C13H17BrO — CID 79726232
1-bromo-7-methoxy-2,3-dimethyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 79726232) has the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. Its IUPAC name is 1-bromo-7-methoxy-2,3-dimethyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-bromo-7-methoxy-2,3-dimethyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 79726232 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-bromo-7-methoxy-2,3-dimethyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1ccc2c(c1)C(Br)C(C)C(C)C2 |
| InChI | InChI=1S/C13H17BrO/c1-8-6-10-4-5-11(15-3)7-12(10)13(14)9(8)2/h4-5,7-9,13H,6H2,1-3H3 |
| InChIKey | LNBRMPLBPHYHAH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|